C10H11F2NO2S — CID 139690013
methyl 2-(5-amino-2,4-difluorophenyl)sulfanylpropanoate (PubChem CID 139690013) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is methyl 2-(5-amino-2,4-difluorophenyl)sulfanylpropanoate.
| Compound Name | methyl 2-(5-amino-2,4-difluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 139690013 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | methyl 2-(5-amino-2,4-difluorophenyl)sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1cc(N)c(F)cc1F |
| InChI | InChI=1S/C10H11F2NO2S/c1-5(10(14)15-2)16-9-4-8(13)6(11)3-7(9)12/h3-5H,13H2,1-2H3 |
| InChIKey | VQXINHZAXHXEKZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|