C14H16F2O3S — CID 139701153
5-(2,2-dimethylpentanoylsulfanyl)-2,4-difluorobenzoic acid (PubChem CID 139701153) has the molecular formula C14H16F2O3S and a molecular weight of 302.34 g/mol. Its IUPAC name is 5-(2,2-dimethylpentanoylsulfanyl)-2,4-difluorobenzoic acid.
| Compound Name | 5-(2,2-dimethylpentanoylsulfanyl)-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 139701153 |
| Molecular Formula | C14H16F2O3S |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-(2,2-dimethylpentanoylsulfanyl)-2,4-difluorobenzoic acid |
| SMILES | CCCC(C)(C)C(=O)Sc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C14H16F2O3S/c1-4-5-14(2,3)13(19)20-11-6-8(12(17)18)9(15)7-10(11)16/h6-7H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | GYINXZOBKJIWAD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|