C14H15F2N3O2S — CID 139701238
S-(5-carbonazidoyl-2,4-difluorophenyl) 2,2-dimethylpentanethioate (PubChem CID 139701238) has the molecular formula C14H15F2N3O2S and a molecular weight of 327.36 g/mol. Its IUPAC name is S-(5-carbonazidoyl-2,4-difluorophenyl) 2,2-dimethylpentanethioate.
| Compound Name | S-(5-carbonazidoyl-2,4-difluorophenyl) 2,2-dimethylpentanethioate |
|---|---|
| PubChem CID | 139701238 |
| Molecular Formula | C14H15F2N3O2S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | S-(5-carbonazidoyl-2,4-difluorophenyl) 2,2-dimethylpentanethioate |
| SMILES | CCCC(C)(C)C(=O)Sc1cc(C(=O)N=[N+]=[N-])c(F)cc1F |
| InChI | InChI=1S/C14H15F2N3O2S/c1-4-5-14(2,3)13(21)22-11-6-8(12(20)18-19-17)9(15)7-10(11)16/h6-7H,4-5H2,1-3H3 |
| InChIKey | MLILUOBALHATFX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|