About S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate
S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate (PubChem CID 139701257) has the molecular formula C12H11ClFN3O2S
and a molecular weight of 315.76 g/mol. Its IUPAC name is S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate.
Molecular Properties
| Compound Name | S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate |
| PubChem CID | 139701257 |
| Molecular Formula | C12H11ClFN3O2S |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate |
| SMILES | CCC(C)C(=O)Sc1cc(C(=O)N=[N+]=[N-])c(F)cc1Cl |
| InChI | InChI=1S/C12H11ClFN3O2S/c1-3-6(2)12(19)20-10-4-7(11(18)16-17-15)9(14)5-8(10)13/h4-6H,3H2,1-2H3 |
| InChIKey | MEWZBPNAHQYLBN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate?
The IUPAC name of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate (CID 139701257) is S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate.
What is the SMILES notation for S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate?
The canonical SMILES for S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate is CCC(C)C(=O)Sc1cc(C(=O)N=[N+]=[N-])c(F)cc1Cl.
What is the InChIKey of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate?
The InChIKey is MEWZBPNAHQYLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClFN3O2S/c1-3-6(2)12(19)20-10-4-7(11(18)16-17-15)9(14)5-8(10)13/h4-6H,3H2,1-2H3.
What are the key properties of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate?
S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate has a molecular weight of 315.76 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2-methylbutanethioate is sourced from PubChem (CID 139701257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).