About S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate
S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate (PubChem CID 139701220) has the molecular formula C14H15ClFN3O2S
and a molecular weight of 343.81 g/mol. Its IUPAC name is S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate.
Molecular Properties
| Compound Name | S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate |
| PubChem CID | 139701220 |
| Molecular Formula | C14H15ClFN3O2S |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate |
| SMILES | CCC(C)CCC(=O)Sc1cc(C(=O)N=[N+]=[N-])c(F)cc1Cl |
| InChI | InChI=1S/C14H15ClFN3O2S/c1-3-8(2)4-5-13(20)22-12-6-9(14(21)18-19-17)11(16)7-10(12)15/h6-8H,3-5H2,1-2H3 |
| InChIKey | SMXDQIYLEXOILH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate?
The IUPAC name of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate (CID 139701220) is S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate.
What is the SMILES notation for S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate?
The canonical SMILES for S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate is CCC(C)CCC(=O)Sc1cc(C(=O)N=[N+]=[N-])c(F)cc1Cl.
What is the InChIKey of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate?
The InChIKey is SMXDQIYLEXOILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClFN3O2S/c1-3-8(2)4-5-13(20)22-12-6-9(14(21)18-19-17)11(16)7-10(12)15/h6-8H,3-5H2,1-2H3.
What are the key properties of S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate?
S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate has a molecular weight of 343.81 g/mol, XLogP of 5.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 4-methylhexanethioate is sourced from PubChem (CID 139701220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).