C13H13ClFN3O2S — CID 139701223
S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2,3-dimethylbutanethioate (PubChem CID 139701223) has the molecular formula C13H13ClFN3O2S and a molecular weight of 329.78 g/mol. Its IUPAC name is S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2,3-dimethylbutanethioate.
| Compound Name | S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2,3-dimethylbutanethioate |
|---|---|
| PubChem CID | 139701223 |
| Molecular Formula | C13H13ClFN3O2S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | S-(5-carbonazidoyl-2-chloro-4-fluorophenyl) 2,3-dimethylbutanethioate |
| SMILES | CC(C)C(C)C(=O)Sc1cc(C(=O)N=[N+]=[N-])c(F)cc1Cl |
| InChI | InChI=1S/C13H13ClFN3O2S/c1-6(2)7(3)13(20)21-11-4-8(12(19)17-18-16)10(15)5-9(11)14/h4-7H,1-3H3 |
| InChIKey | PWJAKLDKEOMRDA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|