C13H14ClFO3 — CID 139689216
4-chloro-5-(2,3-dimethylbutanoyl)-2-fluorobenzoic acid (PubChem CID 139689216) has the molecular formula C13H14ClFO3 and a molecular weight of 272.70 g/mol. Its IUPAC name is 4-chloro-5-(2,3-dimethylbutanoyl)-2-fluorobenzoic acid.
| Compound Name | 4-chloro-5-(2,3-dimethylbutanoyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 139689216 |
| Molecular Formula | C13H14ClFO3 |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 4-chloro-5-(2,3-dimethylbutanoyl)-2-fluorobenzoic acid |
| SMILES | CC(C)C(C)C(=O)c1cc(C(=O)O)c(F)cc1Cl |
| InChI | InChI=1S/C13H14ClFO3/c1-6(2)7(3)12(16)8-4-9(13(17)18)11(15)5-10(8)14/h4-7H,1-3H3,(H,17,18) |
| InChIKey | JHYBWSWSWOGCPI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |