C14H10ClF2NO4S — CID 154747396
4-chloro-2-fluoro-5-[(2-fluorophenyl)-methylsulfamoyl]benzoic acid (PubChem CID 154747396) has the molecular formula C14H10ClF2NO4S and a molecular weight of 361.75 g/mol. Its IUPAC name is 4-chloro-2-fluoro-5-[(2-fluorophenyl)-methylsulfamoyl]benzoic acid.
| Compound Name | 4-chloro-2-fluoro-5-[(2-fluorophenyl)-methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 154747396 |
| Molecular Formula | C14H10ClF2NO4S |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 4-chloro-2-fluoro-5-[(2-fluorophenyl)-methylsulfamoyl]benzoic acid |
| SMILES | CN(c1ccccc1F)S(=O)(=O)c1cc(C(=O)O)c(F)cc1Cl |
| InChI | InChI=1S/C14H10ClF2NO4S/c1-18(12-5-3-2-4-10(12)16)23(21,22)13-6-8(14(19)20)11(17)7-9(13)15/h2-7H,1H3,(H,19,20) |
| InChIKey | ODRUMCUIYYPCKO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |