2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid

C14H10F3NO4S — CID 51099020

IUPAC2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid
SMILESCN(c1ccc(F)cc1)S(=O)(=O)c1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C14H10F3NO4S/c1-18(9-4-2-8(15)3-5-9)23(21,22)13-6-10(14(19)20)11(16)7-12(13)17/h2-7H,1H3,(H,19,20)
InChIKeyVEZGXQLXWAVQIW-UHFFFAOYSA-N
MW345.30 g/mol
LogP2.63
Rot. Bonds4

About 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid

2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid (PubChem CID 51099020) has the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. Its IUPAC name is 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid.

Molecular Properties

Compound Name2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid
PubChem CID51099020
Molecular FormulaC14H10F3NO4S
Molecular Weight345.30 g/mol
Exact Mass345.03
IUPAC Name2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid
SMILESCN(c1ccc(F)cc1)S(=O)(=O)c1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C14H10F3NO4S/c1-18(9-4-2-8(15)3-5-9)23(21,22)13-6-10(14(19)20)11(16)7-12(13)17/h2-7H,1H3,(H,19,20)
InChIKeyVEZGXQLXWAVQIW-UHFFFAOYSA-N
XLogP2.63
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.30
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid?
The IUPAC name of 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid (CID 51099020) is 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid.
What is the SMILES notation for 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid?
The canonical SMILES for 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid is CN(c1ccc(F)cc1)S(=O)(=O)c1cc(C(=O)O)c(F)cc1F.
What is the InChIKey of 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid?
The InChIKey is VEZGXQLXWAVQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO4S/c1-18(9-4-2-8(15)3-5-9)23(21,22)13-6-10(14(19)20)11(16)7-12(13)17/h2-7H,1H3,(H,19,20).
What are the key properties of 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid?
2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid has a molecular weight of 345.30 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid is sourced from PubChem (CID 51099020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).