2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid

C11H10ClF2NO3 — CID 62626388

IUPAC2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid
SMILESCC(C(=O)O)N(C)C(=O)c1cc(F)c(F)cc1Cl
InChIInChI=1S/C11H10ClF2NO3/c1-5(11(17)18)15(2)10(16)6-3-8(13)9(14)4-7(6)12/h3-5H,1-2H3,(H,17,18)
InChIKeySEJIMDKWJDJFPV-UHFFFAOYSA-N
MW277.65 g/mol
LogP2.16
Rot. Bonds3

About 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid

2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid (PubChem CID 62626388) has the molecular formula C11H10ClF2NO3 and a molecular weight of 277.65 g/mol. Its IUPAC name is 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid.

Molecular Properties

Compound Name2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid
PubChem CID62626388
Molecular FormulaC11H10ClF2NO3
Molecular Weight277.65 g/mol
Exact Mass277.03
IUPAC Name2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid
SMILESCC(C(=O)O)N(C)C(=O)c1cc(F)c(F)cc1Cl
InChIInChI=1S/C11H10ClF2NO3/c1-5(11(17)18)15(2)10(16)6-3-8(13)9(14)4-7(6)12/h3-5H,1-2H3,(H,17,18)
InChIKeySEJIMDKWJDJFPV-UHFFFAOYSA-N
XLogP2.16
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.65
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid?
The IUPAC name of 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid (CID 62626388) is 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid.
What is the SMILES notation for 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid?
The canonical SMILES for 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid is CC(C(=O)O)N(C)C(=O)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid?
The InChIKey is SEJIMDKWJDJFPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF2NO3/c1-5(11(17)18)15(2)10(16)6-3-8(13)9(14)4-7(6)12/h3-5H,1-2H3,(H,17,18).
What are the key properties of 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid?
2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid has a molecular weight of 277.65 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-4,5-difluorobenzoyl)-methylamino]propanoic acid is sourced from PubChem (CID 62626388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).