C12H11F4NO3 — CID 119358734
2-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]propanoic acid (PubChem CID 119358734) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 2-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]propanoic acid.
| Compound Name | 2-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119358734 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[[4-fluoro-2-(trifluoromethyl)benzoyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F4NO3/c1-6(11(19)20)17(2)10(18)8-4-3-7(13)5-9(8)12(14,15)16/h3-6H,1-2H3,(H,19,20) |
| InChIKey | GVJFXTJVJDOEPD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |