C18H24F4N2O — CID 67772416
4-fluoro-N-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)-2-(trifluoromethyl)benzamide (PubChem CID 67772416) has the molecular formula C18H24F4N2O and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67772416 |
| Molecular Formula | C18H24F4N2O |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-fluoro-N-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)C(CN1CCCC1)N(C)C(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H24F4N2O/c1-12(2)16(11-24-8-4-5-9-24)23(3)17(25)14-7-6-13(19)10-15(14)18(20,21)22/h6-7,10,12,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | STWIPZMXPBKXPT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |