C22H33FN2O7 — CID 67774412
2,2-dihydroxybutanedioic acid;4-fluoro-N,3-dimethyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide (PubChem CID 67774412) has the molecular formula C22H33FN2O7 and a molecular weight of 456.51 g/mol. Its IUPAC name is 2,2-dihydroxybutanedioic acid;4-fluoro-N,3-dimethyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide.
| Compound Name | 2,2-dihydroxybutanedioic acid;4-fluoro-N,3-dimethyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 67774412 |
| Molecular Formula | C22H33FN2O7 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2,2-dihydroxybutanedioic acid;4-fluoro-N,3-dimethyl-N-[(2S)-3-methyl-1-pyrrolidin-1-ylbutan-2-yl]benzamide |
| SMILES | Cc1cc(C(=O)N(C)[C@H](CN2CCCC2)C(C)C)ccc1F.O=C(O)CC(O)(O)C(=O)O |
| InChI | InChI=1S/C18H27FN2O.C4H6O6/c1-13(2)17(12-21-9-5-6-10-21)20(4)18(22)15-7-8-16(19)14(3)11-15;5-2(6)1-4(9,10)3(7)8/h7-8,11,13,17H,5-6,9-10,12H2,1-4H3;9-10H,1H2,(H,5,6)(H,7,8)/t17-;/m1./s1 |
| InChIKey | PWYKQIXRFHSATJ-UNTBIKODSA-N |
| XLogP | 1.55 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|