C19H29FN2O — CID 67773094
N-ethyl-4-fluoro-3-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide (PubChem CID 67773094) has the molecular formula C19H29FN2O and a molecular weight of 320.45 g/mol. Its IUPAC name is N-ethyl-4-fluoro-3-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide.
| Compound Name | N-ethyl-4-fluoro-3-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 67773094 |
| Molecular Formula | C19H29FN2O |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-ethyl-4-fluoro-3-methyl-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide |
| SMILES | CCN(C(=O)c1ccc(F)c(C)c1)C(CN1CCCC1)C(C)C |
| InChI | InChI=1S/C19H29FN2O/c1-5-22(18(14(2)3)13-21-10-6-7-11-21)19(23)16-8-9-17(20)15(4)12-16/h8-9,12,14,18H,5-7,10-11,13H2,1-4H3 |
| InChIKey | HWAHUGDLHDMUHC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |