C18H15ClF2N4O — CID 51201668
2-chloro-4,5-difluoro-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 51201668) has the molecular formula C18H15ClF2N4O and a molecular weight of 376.79 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 51201668 |
| Molecular Formula | C18H15ClF2N4O |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | CC(c1ccc(-n2cncn2)cc1)N(C)C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C18H15ClF2N4O/c1-11(12-3-5-13(6-4-12)25-10-22-9-23-25)24(2)18(26)14-7-16(20)17(21)8-15(14)19/h3-11H,1-2H3 |
| InChIKey | GUUHDPOELUIJIS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|