C17H13Cl2FN4O — CID 78810362
2,4-dichloro-5-fluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 78810362) has the molecular formula C17H13Cl2FN4O and a molecular weight of 379.22 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 78810362 |
| Molecular Formula | C17H13Cl2FN4O |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(F)c(Cl)cc1Cl)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C17H13Cl2FN4O/c1-10(11-2-4-12(5-3-11)24-9-21-8-22-24)23-17(25)13-6-16(20)15(19)7-14(13)18/h2-10H,1H3,(H,23,25) |
| InChIKey | KXUHZDIZKAXNIS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|