C15H13Cl2FN2O3S — CID 78811687
2,4-dichloro-5-fluoro-N-[1-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 78811687) has the molecular formula C15H13Cl2FN2O3S and a molecular weight of 391.25 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[1-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[1-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 78811687 |
| Molecular Formula | C15H13Cl2FN2O3S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[1-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(F)c(Cl)cc1Cl)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H13Cl2FN2O3S/c1-8(9-2-4-10(5-3-9)24(19,22)23)20-15(21)11-6-14(18)13(17)7-12(11)16/h2-8H,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | VKKQCKFNZUGNJB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|