C18H22ClN3O3S — CID 8540898
2-[(4-chlorophenyl)methyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 8540898) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8540898 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN(C)Cc1ccc(Cl)cc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-13(15-5-9-17(10-6-15)26(20,24)25)21-18(23)12-22(2)11-14-3-7-16(19)8-4-14/h3-10,13H,11-12H2,1-2H3,(H,21,23)(H2,20,24,25)/t13-/m1/s1 |
| InChIKey | YJKPPQBGSYBLEH-CYBMUJFWSA-N |
| XLogP | 2.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |