C19H23ClN2O — CID 9024530
N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[methyl-[(4-methylphenyl)methyl]amino]acetamide (PubChem CID 9024530) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[methyl-[(4-methylphenyl)methyl]amino]acetamide.
| Compound Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[methyl-[(4-methylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9024530 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[methyl-[(4-methylphenyl)methyl]amino]acetamide |
| SMILES | Cc1ccc(CN(C)CC(=O)N[C@@H](C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H23ClN2O/c1-14-4-6-16(7-5-14)12-22(3)13-19(23)21-15(2)17-8-10-18(20)11-9-17/h4-11,15H,12-13H2,1-3H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | YJORACHBKRTCEX-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |