C16H18BrClN2OS — CID 84973908
2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-[1-(4-chlorophenyl)ethyl]acetamide (PubChem CID 84973908) has the molecular formula C16H18BrClN2OS and a molecular weight of 401.76 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-[1-(4-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-[1-(4-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 84973908 |
| Molecular Formula | C16H18BrClN2OS |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-[1-(4-chlorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(C)Cc1ccc(Br)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18BrClN2OS/c1-11(12-3-5-13(18)6-4-12)19-16(21)10-20(2)9-14-7-8-15(17)22-14/h3-8,11H,9-10H2,1-2H3,(H,19,21) |
| InChIKey | QCUAZAGQONOUDW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |