C18H16ClIN4O — CID 55686577
4-chloro-2-iodo-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 55686577) has the molecular formula C18H16ClIN4O and a molecular weight of 466.71 g/mol. Its IUPAC name is 4-chloro-2-iodo-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-chloro-2-iodo-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 55686577 |
| Molecular Formula | C18H16ClIN4O |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 4-chloro-2-iodo-N-methyl-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | CC(c1ccc(-n2cncn2)cc1)N(C)C(=O)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C18H16ClIN4O/c1-12(13-3-6-15(7-4-13)24-11-21-10-22-24)23(2)18(25)16-8-5-14(19)9-17(16)20/h3-12H,1-2H3 |
| InChIKey | FCFHJEOCEUANMT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|