C10H6F3N3O — CID 170225134
(Z)-3-azido-4-(2,4,5-trifluorophenyl)but-3-en-2-one (PubChem CID 170225134) has the molecular formula C10H6F3N3O and a molecular weight of 241.17 g/mol. Its IUPAC name is (Z)-3-azido-4-(2,4,5-trifluorophenyl)but-3-en-2-one.
| Compound Name | (Z)-3-azido-4-(2,4,5-trifluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 170225134 |
| Molecular Formula | C10H6F3N3O |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (Z)-3-azido-4-(2,4,5-trifluorophenyl)but-3-en-2-one |
| SMILES | CC(=O)/C(=C/c1cc(F)c(F)cc1F)N=[N+]=[N-] |
| InChI | InChI=1S/C10H6F3N3O/c1-5(17)10(15-16-14)3-6-2-8(12)9(13)4-7(6)11/h2-4H,1H3/b10-3- |
| InChIKey | UPGRSMOFKSIDBO-KMKOMSMNSA-N |
| XLogP | 3.34 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|