C11H10BrN3O4 — CID 137376119
(Z)-2-azido-3-(5-bromo-2,3-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 137376119) has the molecular formula C11H10BrN3O4 and a molecular weight of 328.12 g/mol. Its IUPAC name is (Z)-2-azido-3-(5-bromo-2,3-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-azido-3-(5-bromo-2,3-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 137376119 |
| Molecular Formula | C11H10BrN3O4 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | (Z)-2-azido-3-(5-bromo-2,3-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(Br)cc(/C=C(\N=[N+]=[N-])C(=O)O)c1OC |
| InChI | InChI=1S/C11H10BrN3O4/c1-18-9-5-7(12)3-6(10(9)19-2)4-8(11(16)17)14-15-13/h3-5H,1-2H3,(H,16,17)/b8-4- |
| InChIKey | SKLFNRNLVKAUCV-YWEYNIOJSA-N |
| XLogP | 3.20 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|