C16H12Br2O3 — CID 43169992
(Z)-3-(3,5-dibromo-2-methoxyphenyl)-2-phenylprop-2-enoic acid (PubChem CID 43169992) has the molecular formula C16H12Br2O3 and a molecular weight of 412.08 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-2-methoxyphenyl)-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-(3,5-dibromo-2-methoxyphenyl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 43169992 |
| Molecular Formula | C16H12Br2O3 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | (Z)-3-(3,5-dibromo-2-methoxyphenyl)-2-phenylprop-2-enoic acid |
| SMILES | COc1c(Br)cc(Br)cc1/C=C(\C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H12Br2O3/c1-21-15-11(7-12(17)9-14(15)18)8-13(16(19)20)10-5-3-2-4-6-10/h2-9H,1H3,(H,19,20)/b13-8- |
| InChIKey | HDOVDTCAWYJEBK-JYRVWZFOSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|