C11H13Br2NO — CID 79330153
3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-amine (PubChem CID 79330153) has the molecular formula C11H13Br2NO and a molecular weight of 335.04 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-amine.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79330153 |
| Molecular Formula | C11H13Br2NO |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-amine |
| SMILES | COc1c(Br)cc(Br)cc1C=C(C)CN |
| InChI | InChI=1S/C11H13Br2NO/c1-7(6-14)3-8-4-9(12)5-10(13)11(8)15-2/h3-5H,6,14H2,1-2H3 |
| InChIKey | BXMVAWSLIXLFGD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |