C11H10Br2O2 — CID 79331096
3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-enal (PubChem CID 79331096) has the molecular formula C11H10Br2O2 and a molecular weight of 334.01 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-enal.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-enal |
|---|---|
| PubChem CID | 79331096 |
| Molecular Formula | C11H10Br2O2 |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.90 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-enal |
| SMILES | COc1c(Br)cc(Br)cc1C=C(C)C=O |
| InChI | InChI=1S/C11H10Br2O2/c1-7(6-14)3-8-4-9(12)5-10(13)11(8)15-2/h3-6H,1-2H3 |
| InChIKey | BCGLPLNDNLHIOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|