C11H12Br2O2 — CID 79335248
3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-ol (PubChem CID 79335248) has the molecular formula C11H12Br2O2 and a molecular weight of 336.02 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-ol.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 79335248 |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-2-methylprop-2-en-1-ol |
| SMILES | COc1c(Br)cc(Br)cc1C=C(C)CO |
| InChI | InChI=1S/C11H12Br2O2/c1-7(6-14)3-8-4-9(12)5-10(13)11(8)15-2/h3-5,14H,6H2,1-2H3 |
| InChIKey | YXRNHXJKGIHGOJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |