C13H16Br2O2 — CID 79334797
3-(3,5-dibromo-2-propoxyphenyl)-2-methylprop-2-en-1-ol (PubChem CID 79334797) has the molecular formula C13H16Br2O2 and a molecular weight of 364.08 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-propoxyphenyl)-2-methylprop-2-en-1-ol.
| Compound Name | 3-(3,5-dibromo-2-propoxyphenyl)-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 79334797 |
| Molecular Formula | C13H16Br2O2 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 3-(3,5-dibromo-2-propoxyphenyl)-2-methylprop-2-en-1-ol |
| SMILES | CCCOc1c(Br)cc(Br)cc1C=C(C)CO |
| InChI | InChI=1S/C13H16Br2O2/c1-3-4-17-13-10(5-9(2)8-16)6-11(14)7-12(13)15/h5-7,16H,3-4,8H2,1-2H3 |
| InChIKey | DHTKBRVHQAGTMN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |