C11H11Br2NO3 — CID 55017468
1,5-dibromo-3-[(E)-2-nitroethenyl]-2-propoxybenzene (PubChem CID 55017468) has the molecular formula C11H11Br2NO3 and a molecular weight of 365.02 g/mol. Its IUPAC name is 1,5-dibromo-3-[(E)-2-nitroethenyl]-2-propoxybenzene.
| Compound Name | 1,5-dibromo-3-[(E)-2-nitroethenyl]-2-propoxybenzene |
|---|---|
| PubChem CID | 55017468 |
| Molecular Formula | C11H11Br2NO3 |
| Molecular Weight | 365.02 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | 1,5-dibromo-3-[(E)-2-nitroethenyl]-2-propoxybenzene |
| SMILES | CCCOc1c(Br)cc(Br)cc1/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C11H11Br2NO3/c1-2-5-17-11-8(3-4-14(15)16)6-9(12)7-10(11)13/h3-4,6-7H,2,5H2,1H3/b4-3+ |
| InChIKey | KAKCYEHJLXWBGQ-ONEGZZNKSA-N |
| XLogP | 4.25 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|