C17H23NO4 — CID 70623059
7-(2-nitroethenyl)-4,5-dipropoxy-2,3-dihydro-1H-indene (PubChem CID 70623059) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 7-(2-nitroethenyl)-4,5-dipropoxy-2,3-dihydro-1H-indene.
| Compound Name | 7-(2-nitroethenyl)-4,5-dipropoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 70623059 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 7-(2-nitroethenyl)-4,5-dipropoxy-2,3-dihydro-1H-indene |
| SMILES | CCCOc1cc(C=C[N+](=O)[O-])c2c(c1OCCC)CCC2 |
| InChI | InChI=1S/C17H23NO4/c1-3-10-21-16-12-13(8-9-18(19)20)14-6-5-7-15(14)17(16)22-11-4-2/h8-9,12H,3-7,10-11H2,1-2H3 |
| InChIKey | ASZRFUOPBLFHEA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|