C15H11Br2NO3 — CID 5368263
1,5-dibromo-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene (PubChem CID 5368263) has the molecular formula C15H11Br2NO3 and a molecular weight of 413.07 g/mol. Its IUPAC name is 1,5-dibromo-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene.
| Compound Name | 1,5-dibromo-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 5368263 |
| Molecular Formula | C15H11Br2NO3 |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 1,5-dibromo-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene |
| SMILES | O=[N+]([O-])/C=C/c1cc(Br)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H11Br2NO3/c16-13-8-12(6-7-18(19)20)15(14(17)9-13)21-10-11-4-2-1-3-5-11/h1-9H,10H2/b7-6+ |
| InChIKey | BLLUUEFMEUNWQH-VOTSOKGWSA-N |
| XLogP | 5.04 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|