C29H24N2O7 — CID 14164851
2-nitro-3-[(E)-2-nitroethenyl]-1,4,5-tris(phenylmethoxy)benzene (PubChem CID 14164851) has the molecular formula C29H24N2O7 and a molecular weight of 512.52 g/mol. Its IUPAC name is 2-nitro-3-[(E)-2-nitroethenyl]-1,4,5-tris(phenylmethoxy)benzene.
| Compound Name | 2-nitro-3-[(E)-2-nitroethenyl]-1,4,5-tris(phenylmethoxy)benzene |
|---|---|
| PubChem CID | 14164851 |
| Molecular Formula | C29H24N2O7 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-nitro-3-[(E)-2-nitroethenyl]-1,4,5-tris(phenylmethoxy)benzene |
| SMILES | O=[N+]([O-])/C=C/c1c(OCc2ccccc2)c(OCc2ccccc2)cc(OCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24N2O7/c32-30(33)17-16-25-28(31(34)35)26(36-19-22-10-4-1-5-11-22)18-27(37-20-23-12-6-2-7-13-23)29(25)38-21-24-14-8-3-9-15-24/h1-18H,19-21H2/b17-16+ |
| InChIKey | ZHHNOIFIFKTPPA-WUKNDPDISA-N |
| XLogP | 6.58 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|