C27H21F2NO5 — CID 10743231
1,3-difluoro-5-nitro-2,4,6-tris(phenylmethoxy)benzene (PubChem CID 10743231) has the molecular formula C27H21F2NO5 and a molecular weight of 477.46 g/mol. Its IUPAC name is 1,3-difluoro-5-nitro-2,4,6-tris(phenylmethoxy)benzene.
| Compound Name | 1,3-difluoro-5-nitro-2,4,6-tris(phenylmethoxy)benzene |
|---|---|
| PubChem CID | 10743231 |
| Molecular Formula | C27H21F2NO5 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1,3-difluoro-5-nitro-2,4,6-tris(phenylmethoxy)benzene |
| SMILES | O=[N+]([O-])c1c(OCc2ccccc2)c(F)c(OCc2ccccc2)c(F)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H21F2NO5/c28-22-25(33-16-19-10-4-1-5-11-19)23(29)27(35-18-21-14-8-3-9-15-21)24(30(31)32)26(22)34-17-20-12-6-2-7-13-20/h1-15H,16-18H2 |
| InChIKey | AFNFHOVIGHGLGP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|