C26H20F4N2O4 — CID 160758760
1,5-difluoro-2-nitro-3-phenylmethoxybenzene;2,4-difluoro-6-phenylmethoxyaniline (PubChem CID 160758760) has the molecular formula C26H20F4N2O4 and a molecular weight of 500.45 g/mol. Its IUPAC name is 1,5-difluoro-2-nitro-3-phenylmethoxybenzene;2,4-difluoro-6-phenylmethoxyaniline.
| Compound Name | 1,5-difluoro-2-nitro-3-phenylmethoxybenzene;2,4-difluoro-6-phenylmethoxyaniline |
|---|---|
| PubChem CID | 160758760 |
| Molecular Formula | C26H20F4N2O4 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 1,5-difluoro-2-nitro-3-phenylmethoxybenzene;2,4-difluoro-6-phenylmethoxyaniline |
| SMILES | Nc1c(F)cc(F)cc1OCc1ccccc1.O=[N+]([O-])c1c(F)cc(F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C13H9F2NO3.C13H11F2NO/c14-10-6-11(15)13(16(17)18)12(7-10)19-8-9-4-2-1-3-5-9;14-10-6-11(15)13(16)12(7-10)17-8-9-4-2-1-3-5-9/h1-7H,8H2;1-7H,8,16H2 |
| InChIKey | RXTVYQOVZIQNKE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|