C13H10F2N2O3 — CID 106485742
[4-(3,5-difluoro-2-nitrophenoxy)phenyl]methanamine (PubChem CID 106485742) has the molecular formula C13H10F2N2O3 and a molecular weight of 280.23 g/mol. Its IUPAC name is [4-(3,5-difluoro-2-nitrophenoxy)phenyl]methanamine.
| Compound Name | [4-(3,5-difluoro-2-nitrophenoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 106485742 |
| Molecular Formula | C13H10F2N2O3 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [4-(3,5-difluoro-2-nitrophenoxy)phenyl]methanamine |
| SMILES | NCc1ccc(Oc2cc(F)cc(F)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10F2N2O3/c14-9-5-11(15)13(17(18)19)12(6-9)20-10-3-1-8(7-16)2-4-10/h1-6H,7,16H2 |
| InChIKey | ALEZOGNUMIUUGY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|