C17H16ClN7O5 — CID 162140600
4-[4-(aminomethyl)phenoxy]-3-nitropyridin-2-amine;4-chloro-3-nitropyridin-2-amine (PubChem CID 162140600) has the molecular formula C17H16ClN7O5 and a molecular weight of 433.81 g/mol. Its IUPAC name is 4-[4-(aminomethyl)phenoxy]-3-nitropyridin-2-amine;4-chloro-3-nitropyridin-2-amine.
| Compound Name | 4-[4-(aminomethyl)phenoxy]-3-nitropyridin-2-amine;4-chloro-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 162140600 |
| Molecular Formula | C17H16ClN7O5 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 4-[4-(aminomethyl)phenoxy]-3-nitropyridin-2-amine;4-chloro-3-nitropyridin-2-amine |
| SMILES | NCc1ccc(Oc2ccnc(N)c2[N+](=O)[O-])cc1.Nc1nccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O3.C5H4ClN3O2/c13-7-8-1-3-9(4-2-8)19-10-5-6-15-12(14)11(10)16(17)18;6-3-1-2-8-5(7)4(3)9(10)11/h1-6H,7,13H2,(H2,14,15);1-2H,(H2,7,8) |
| InChIKey | ZJWLDCQBIOTODR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 199.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|