C26H20N4O5 — CID 141307800
9H-fluoren-9-yl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]phenyl]-N-methylcarbamate (PubChem CID 141307800) has the molecular formula C26H20N4O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]phenyl]-N-methylcarbamate.
| Compound Name | 9H-fluoren-9-yl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 141307800 |
| Molecular Formula | C26H20N4O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 9H-fluoren-9-yl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC1c2ccccc2-c2ccccc21)c1ccc(Oc2ccnc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H20N4O5/c1-29(16-10-12-17(13-11-16)34-22-14-15-28-25(27)23(22)30(32)33)26(31)35-24-20-8-4-2-6-18(20)19-7-3-5-9-21(19)24/h2-15,24H,1H3,(H2,27,28) |
| InChIKey | JMFNTVLZOLIXQS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|