C13H11FN4O5 — CID 87369559
fluoro-[4-[[2-(methylamino)-3-nitro-4-pyridinyl]oxy]phenyl]carbamic acid (PubChem CID 87369559) has the molecular formula C13H11FN4O5 and a molecular weight of 322.25 g/mol. Its IUPAC name is fluoro-[4-[[2-(methylamino)-3-nitro-4-pyridinyl]oxy]phenyl]carbamic acid.
| Compound Name | fluoro-[4-[[2-(methylamino)-3-nitro-4-pyridinyl]oxy]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87369559 |
| Molecular Formula | C13H11FN4O5 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | fluoro-[4-[[2-(methylamino)-3-nitro-4-pyridinyl]oxy]phenyl]carbamic acid |
| SMILES | CNc1nccc(Oc2ccc(N(F)C(=O)O)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11FN4O5/c1-15-12-11(18(21)22)10(6-7-16-12)23-9-4-2-8(3-5-9)17(14)13(19)20/h2-7H,1H3,(H,15,16)(H,19,20) |
| InChIKey | JSFIZCHGBGBNQK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|