C13H20N4O4 — CID 124881906
N-[(2S,4R)-4-hydroxy-2-methylpentyl]-2-(methylamino)-3-nitropyridine-4-carboxamide (PubChem CID 124881906) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(2S,4R)-4-hydroxy-2-methylpentyl]-2-(methylamino)-3-nitropyridine-4-carboxamide.
| Compound Name | N-[(2S,4R)-4-hydroxy-2-methylpentyl]-2-(methylamino)-3-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 124881906 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[(2S,4R)-4-hydroxy-2-methylpentyl]-2-(methylamino)-3-nitropyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NC[C@@H](C)C[C@@H](C)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O4/c1-8(6-9(2)18)7-16-13(19)10-4-5-15-12(14-3)11(10)17(20)21/h4-5,8-9,18H,6-7H2,1-3H3,(H,14,15)(H,16,19)/t8-,9+/m0/s1 |
| InChIKey | XSACCPYUQDSDFQ-DTWKUNHWSA-N |
| XLogP | 1.17 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|