C11H14ClN3O4 — CID 113429004
2-chloro-3-nitro-N-(2-propan-2-yloxyethyl)pyridine-4-carboxamide (PubChem CID 113429004) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-chloro-3-nitro-N-(2-propan-2-yloxyethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-3-nitro-N-(2-propan-2-yloxyethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 113429004 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-chloro-3-nitro-N-(2-propan-2-yloxyethyl)pyridine-4-carboxamide |
| SMILES | CC(C)OCCNC(=O)c1ccnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14ClN3O4/c1-7(2)19-6-5-14-11(16)8-3-4-13-10(12)9(8)15(17)18/h3-4,7H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | HBFYIIXKOKQFTI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|