C8H9ClN4O3 — CID 83014753
2-chloro-N',N'-dimethyl-3-nitropyridine-4-carbohydrazide (PubChem CID 83014753) has the molecular formula C8H9ClN4O3 and a molecular weight of 244.64 g/mol. Its IUPAC name is 2-chloro-N',N'-dimethyl-3-nitropyridine-4-carbohydrazide.
| Compound Name | 2-chloro-N',N'-dimethyl-3-nitropyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 83014753 |
| Molecular Formula | C8H9ClN4O3 |
| Molecular Weight | 244.64 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-chloro-N',N'-dimethyl-3-nitropyridine-4-carbohydrazide |
| SMILES | CN(C)NC(=O)c1ccnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9ClN4O3/c1-12(2)11-8(14)5-3-4-10-7(9)6(5)13(15)16/h3-4H,1-2H3,(H,11,14) |
| InChIKey | DOLIGUQIEZIILO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.64 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|