C6H4ClN3O6 — CID 175487239
2-chloro-3-nitropyridine-4-carboxylic acid;nitrous acid (PubChem CID 175487239) has the molecular formula C6H4ClN3O6 and a molecular weight of 249.57 g/mol. Its IUPAC name is 2-chloro-3-nitropyridine-4-carboxylic acid;nitrous acid.
| Compound Name | 2-chloro-3-nitropyridine-4-carboxylic acid;nitrous acid |
|---|---|
| PubChem CID | 175487239 |
| Molecular Formula | C6H4ClN3O6 |
| Molecular Weight | 249.57 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2-chloro-3-nitropyridine-4-carboxylic acid;nitrous acid |
| SMILES | O=C(O)c1ccnc(Cl)c1[N+](=O)[O-].O=NO |
| InChI | InChI=1S/C6H3ClN2O4.HNO2/c7-5-4(9(12)13)3(6(10)11)1-2-8-5;2-1-3/h1-2H,(H,10,11);(H,2,3) |
| InChIKey | RBMJJDYVJOXTDN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.57 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|