C18H28N4O3 — CID 143215967
ethane;ethyl N-[2-amino-4-(4-aminophenoxy)-3-pyridinyl]-N-methylcarbamate;methane (PubChem CID 143215967) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethane;ethyl N-[2-amino-4-(4-aminophenoxy)-3-pyridinyl]-N-methylcarbamate;methane.
| Compound Name | ethane;ethyl N-[2-amino-4-(4-aminophenoxy)-3-pyridinyl]-N-methylcarbamate;methane |
|---|---|
| PubChem CID | 143215967 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | ethane;ethyl N-[2-amino-4-(4-aminophenoxy)-3-pyridinyl]-N-methylcarbamate;methane |
| SMILES | C.CC.CCOC(=O)N(C)c1c(Oc2ccc(N)cc2)ccnc1N |
| InChI | InChI=1S/C15H18N4O3.C2H6.CH4/c1-3-21-15(20)19(2)13-12(8-9-18-14(13)17)22-11-6-4-10(16)5-7-11;1-2;/h4-9H,3,16H2,1-2H3,(H2,17,18);1-2H3;1H4 |
| InChIKey | FYLVNFRBKHDUIL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|