C16H15Cl2NO3 — CID 89159446
ethyl 2-[4-(4-aminophenoxy)-2,5-dichlorophenyl]acetate (PubChem CID 89159446) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is ethyl 2-[4-(4-aminophenoxy)-2,5-dichlorophenyl]acetate.
| Compound Name | ethyl 2-[4-(4-aminophenoxy)-2,5-dichlorophenyl]acetate |
|---|---|
| PubChem CID | 89159446 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | ethyl 2-[4-(4-aminophenoxy)-2,5-dichlorophenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(Cl)c(Oc2ccc(N)cc2)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO3/c1-2-21-16(20)8-10-7-14(18)15(9-13(10)17)22-12-5-3-11(19)4-6-12/h3-7,9H,2,8,19H2,1H3 |
| InChIKey | PXABDHVRKVZNSP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|