C12H12BrClF2O3 — CID 171012483
ethyl 2-[5-(bromomethyl)-2-chloro-4-(difluoromethoxy)phenyl]acetate (PubChem CID 171012483) has the molecular formula C12H12BrClF2O3 and a molecular weight of 357.58 g/mol. Its IUPAC name is ethyl 2-[5-(bromomethyl)-2-chloro-4-(difluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[5-(bromomethyl)-2-chloro-4-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 171012483 |
| Molecular Formula | C12H12BrClF2O3 |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | ethyl 2-[5-(bromomethyl)-2-chloro-4-(difluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CBr)c(OC(F)F)cc1Cl |
| InChI | InChI=1S/C12H12BrClF2O3/c1-2-18-11(17)4-7-3-8(6-13)10(5-9(7)14)19-12(15)16/h3,5,12H,2,4,6H2,1H3 |
| InChIKey | XIRIJILLMOSBGU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|