C12H12BrF2NO5 — CID 171017336
ethyl 2-[5-(bromomethyl)-4-(difluoromethoxy)-2-nitrophenyl]acetate (PubChem CID 171017336) has the molecular formula C12H12BrF2NO5 and a molecular weight of 368.13 g/mol. Its IUPAC name is ethyl 2-[5-(bromomethyl)-4-(difluoromethoxy)-2-nitrophenyl]acetate.
| Compound Name | ethyl 2-[5-(bromomethyl)-4-(difluoromethoxy)-2-nitrophenyl]acetate |
|---|---|
| PubChem CID | 171017336 |
| Molecular Formula | C12H12BrF2NO5 |
| Molecular Weight | 368.13 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | ethyl 2-[5-(bromomethyl)-4-(difluoromethoxy)-2-nitrophenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CBr)c(OC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12BrF2NO5/c1-2-20-11(17)4-7-3-8(6-13)10(21-12(14)15)5-9(7)16(18)19/h3,5,12H,2,4,6H2,1H3 |
| InChIKey | OBYIADSAPKBWDN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|