C11H10Cl2F2O3 — CID 121228272
ethyl 2-[2,4-dichloro-6-(difluoromethoxy)phenyl]acetate (PubChem CID 121228272) has the molecular formula C11H10Cl2F2O3 and a molecular weight of 299.10 g/mol. Its IUPAC name is ethyl 2-[2,4-dichloro-6-(difluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[2,4-dichloro-6-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 121228272 |
| Molecular Formula | C11H10Cl2F2O3 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | ethyl 2-[2,4-dichloro-6-(difluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(Cl)cc(Cl)cc1OC(F)F |
| InChI | InChI=1S/C11H10Cl2F2O3/c1-2-17-10(16)5-7-8(13)3-6(12)4-9(7)18-11(14)15/h3-4,11H,2,5H2,1H3 |
| InChIKey | RHSMQPYZZOOTJI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |