C18H27N3O4S — CID 173258334
5-amino-2-(4-aminophenoxy)benzenesulfonic acid;N,N-diethylethanamine (PubChem CID 173258334) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 5-amino-2-(4-aminophenoxy)benzenesulfonic acid;N,N-diethylethanamine.
| Compound Name | 5-amino-2-(4-aminophenoxy)benzenesulfonic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 173258334 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 5-amino-2-(4-aminophenoxy)benzenesulfonic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1ccc(Oc2ccc(N)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H12N2O4S.C6H15N/c13-8-1-4-10(5-2-8)18-11-6-3-9(14)7-12(11)19(15,16)17;1-4-7(5-2)6-3/h1-7H,13-14H2,(H,15,16,17);4-6H2,1-3H3 |
| InChIKey | LMORUYZCTJULEL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|