C20H29N3O5S — CID 159744653
5-amino-2-ethoxybenzenesulfonic acid;N-[3-(diethylamino)phenyl]acetamide (PubChem CID 159744653) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 5-amino-2-ethoxybenzenesulfonic acid;N-[3-(diethylamino)phenyl]acetamide.
| Compound Name | 5-amino-2-ethoxybenzenesulfonic acid;N-[3-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 159744653 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-amino-2-ethoxybenzenesulfonic acid;N-[3-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1cccc(NC(C)=O)c1.CCOc1ccc(N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H18N2O.C8H11NO4S/c1-4-14(5-2)12-8-6-7-11(9-12)13-10(3)15;1-2-13-7-4-3-6(9)5-8(7)14(10,11)12/h6-9H,4-5H2,1-3H3,(H,13,15);3-5H,2,9H2,1H3,(H,10,11,12) |
| InChIKey | NCWVTAZXAKDITE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|