C24H25N3O4 — CID 108519870
N'-(4-aminophenyl)-N-(3,4-diethoxyphenyl)-N'-phenyloxamide (PubChem CID 108519870) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N-(3,4-diethoxyphenyl)-N'-phenyloxamide.
| Compound Name | N'-(4-aminophenyl)-N-(3,4-diethoxyphenyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 108519870 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N'-(4-aminophenyl)-N-(3,4-diethoxyphenyl)-N'-phenyloxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)N(c2ccccc2)c2ccc(N)cc2)cc1OCC |
| InChI | InChI=1S/C24H25N3O4/c1-3-30-21-15-12-18(16-22(21)31-4-2)26-23(28)24(29)27(19-8-6-5-7-9-19)20-13-10-17(25)11-14-20/h5-16H,3-4,25H2,1-2H3,(H,26,28) |
| InChIKey | KMEDZZGSBAMDEJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|